Cyclapolin 1 structure
|
Common Name | Cyclapolin 1 | ||
|---|---|---|---|---|
| CAS Number | 736157-02-1 | Molecular Weight | 339.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4F3N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyclapolin 1Cyclapolin 1 is a potent and selective PLK1 inhibitor that promotes loss of centrosome integrity and microtubule nucleating ability apparently through increased accessibility of protein phosphatases. |
| Name | 7-nitro-3-oxido-5-(trifluoromethylsulfanyl)-1,3-benzothiazol-3-ium-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H4F3N3O4S2 |
|---|---|
| Molecular Weight | 339.27100 |
| Exact Mass | 338.96000 |
| PSA | 167.91000 |
| LogP | 4.17230 |
| InChIKey | IRJROIRFULTGIX-UHFFFAOYSA-N |
| SMILES | NC(=O)c1sc2c([N+](=O)[O-])cc(SC(F)(F)F)cc2[n+]1[O-] |
| Cyclapolin 1 |
| 2-Benzothiazolecarboxamide,7-nitro-5-[(trifluoromethyl)thio]-,3-oxide |