1-(4-Acetyl-1-naphtyloxy)-3-butanol structure
|
Common Name | 1-(4-Acetyl-1-naphtyloxy)-3-butanol | ||
|---|---|---|---|---|
| CAS Number | 73622-72-7 | Molecular Weight | 258.31200 | |
| Density | 1.14g/cm3 | Boiling Point | 449.4ºC at 760 mmHg | |
| Molecular Formula | C16H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 1-[4-(3-hydroxybutoxy)naphthalen-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 449.4ºC at 760 mmHg |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31200 |
| Flash Point | 167.1ºC |
| Exact Mass | 258.12600 |
| PSA | 46.53000 |
| LogP | 3.19210 |
| Index of Refraction | 1.587 |
| InChIKey | ALDOODCGTDEHDY-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCCC(C)O)c2ccccc12 |
|
~%
1-(4-Acetyl-1-n... CAS#:73622-72-7 |
| Literature: Hunter,W.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 167 - 174 |
|
~%
1-(4-Acetyl-1-n... CAS#:73622-72-7 |
| Literature: Hunter,W.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 167 - 174 |
| 3-Butanol,1-(4-acetyl-1-naphthyloxy) |
| 1-(4-Acetyl-1-naphthyloxy)-3-butanol |
| 1'-ACETONAPHTHONE,4'-(3-HYDROXYBUTOXY) |
| 4-(4-Acetyl-1-naphthoxy)-butanol-(2) |
| 4'-(3-Hydroxybutoxy)-1'-acetonaphthone |