adenosine cyclic 2',3'-(hydrogen phosphate), compound with triethylamine (1:1) structure
|
Common Name | adenosine cyclic 2',3'-(hydrogen phosphate), compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 73647-07-1 | Molecular Weight | 430.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27N6O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethylammonium adenosine cyclic 2',3'-phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H27N6O6P |
|---|---|
| Molecular Weight | 430.39600 |
| Exact Mass | 430.17300 |
| PSA | 167.89000 |
| LogP | 1.11190 |
| InChIKey | QVJJZPQQHXBBJK-MCDZGGTQSA-N |
| SMILES | CCN(CC)CC.Nc1ncnc2c1ncn2C1OC(CO)C2OP(=O)(O)OC21 |
| Et3NH(2',3'-cAMP) |
| (3aR,4R,6R,6aR)-4-(6-Amino-purin-9-yl)-6-hydroxymethyl-2-oxo-tetrahydro-2λ5-furo[3,4-d][1,3,2]dioxaphosphol-2-ol |
| compound with triethyl-amine |
| triethylammonium 4-(6-aminopurin-9-yl)-6-hydroxymethyl-2-oxido-2-oxoperhydrofurano[3,4-c][1,3,2]dioxaphosphole |
| adenosine cyclic 2',3'-(hydrogen phosphate), compound with triethylamine (1:1) |