Guanosine 2',3'-Cyclic Phosphate Triethylamine Salt structure
|
Common Name | Guanosine 2',3'-Cyclic Phosphate Triethylamine Salt | ||
|---|---|---|---|---|
| CAS Number | 73647-09-3 | Molecular Weight | 446.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27N6O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Guanosine 2',3'-Cyclic Phosphate Triethylamine Salt2′,3′-cGMP triethylamine (Guanosine 2',3'-cyclic phosphate triethylamine) is an active compound. 2′,3′-cGMP triethylamine can be used for various studies[1]. |
| Name | 9-[(3aR,4R,6R,6aR)-2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-2-amino-3H-purin-6-one,N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | 2′,3′-cGMP triethylamine (Guanosine 2',3'-cyclic phosphate triethylamine) is an active compound. 2′,3′-cGMP triethylamine can be used for various studies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H27N6O7P |
|---|---|
| Molecular Weight | 446.39500 |
| Exact Mass | 446.16800 |
| PSA | 188.85000 |
| LogP | 0.16640 |
| InChIKey | XSJQZRFQUIJXDC-GWTDSMLYSA-N |
| SMILES | CCN(CC)CC.Nc1nc2c(ncn2C2OC(CO)C3OP(=O)(O)OC32)c(=O)[nH]1 |
| Guanosine Cyclic 2',3'-(Hydrogen Phosphate) N,N-Diethylethanamine |
| Guanosine 2',3'-Cyclic Monophosphate Triethylamine Salt |