N-Allyl-3,4-dimethoxybenzamide structure
|
Common Name | N-Allyl-3,4-dimethoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 73664-69-4 | Molecular Weight | 221.25200 | |
| Density | 1.074g/cm3 | Boiling Point | 336.8ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.5ºC | |
| Name | 3,4-dimethoxy-N-prop-2-enylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 157.5ºC |
| Exact Mass | 221.10500 |
| PSA | 51.05000 |
| LogP | 2.19440 |
| Index of Refraction | 1.516 |
| InChIKey | DISIZJPNVAUNCI-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)c1ccc(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Allyl-3,4-dimethoxybenzamide |
| BENZAMIDE,N-ALLYL-3,4-DIMETHOXY |
| 3,4-dimethoxy-N-(prop-2-en-1-yl)benzamide |
| N-Allyl-3,4-dimethoxy-benzoesaeureamid |