Glycine, (3b)-cholest-5-en-3-yl ester structure
|
Common Name | Glycine, (3b)-cholest-5-en-3-yl ester | ||
|---|---|---|---|---|
| CAS Number | 73670-26-5 | Molecular Weight | 443.70500 | |
| Density | 1.02g/cm3 | Boiling Point | 517.3ºC at 760mmHg | |
| Molecular Formula | C29H49NO2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 317.5ºC | |
| Name | cholesteryl dodecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760mmHg |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.70500 |
| Flash Point | 317.5ºC |
| Exact Mass | 443.37600 |
| PSA | 52.32000 |
| LogP | 7.59860 |
| Index of Refraction | 1.527 |
| InChIKey | CJBSWQQUBIQQKU-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CN)CCC4(C)C3CCC12C |
|
~%
Glycine, (3b)-c... CAS#:73670-26-5 |
| Literature: Prokai, Laszlo; Prokai-Tatrai, Katalin; Ouyang, Xudong; Kim, Ho-Seung; Wu, Whei-Mei; Zharikova, Alevtina; Bodor, Nicholas Journal of Medicinal Chemistry, 1999 , vol. 42, # 22 p. 4563 - 4571 |
|
~%
Glycine, (3b)-c... CAS#:73670-26-5 |
| Literature: Prokai, Laszlo; Prokai-Tatrai, Katalin; Ouyang, Xudong; Kim, Ho-Seung; Wu, Whei-Mei; Zharikova, Alevtina; Bodor, Nicholas Journal of Medicinal Chemistry, 1999 , vol. 42, # 22 p. 4563 - 4571 |
|
~%
Glycine, (3b)-c... CAS#:73670-26-5 |
| Literature: Baniel et al. Journal of Organic Chemistry, 1948 , vol. 13, p. 791,794 |
|
~%
Glycine, (3b)-c... CAS#:73670-26-5 |
| Literature: Abderhalden; Kautzsch Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1910 , vol. 65, p. 77 |
| cholesterol glycinate |
| cholesterol n-dodecanoate |
| O-lauroyl-cholesterol |
| Laurinsaeure-cholesterylester |
| Dodecanoic acid,cholesteryl ester |
| CE(12:0) |
| cholesterol laurate |
| O-glycyl-cholesterol |
| Cholest-5-en-3beta-ol dodecanoate |
| cholest-5-en-3Beta-yl dodecanoate |
| cholesteryl glycinate |
| Cholesteryl Fluoroformate |
| 3-cholesterylfluoroformate |
| cholesteryl laurate |
| Aminoessigsaeure-cholesterylester |