N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine
![N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine Structure](https://image.chemsrc.com/caspic/063/73675-52-2.png)
N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine structure
|
Common Name | N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 73675-52-2 | Molecular Weight | 295.41900 | |
| Density | 1.031g/cm3 | Boiling Point | 428.7ºC at 760 mmHg | |
| Molecular Formula | C20H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.6ºC | |
Summary: N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine, CAS number 73675-52-2, molecular formula C20H25NO, molecular weight 295.41900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760 mmHg |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.41900 |
| Flash Point | 125.6ºC |
| Exact Mass | 295.19400 |
| PSA | 12.47000 |
| LogP | 4.57760 |
| Index of Refraction | 1.594 |
| InChIKey | BXEBFKORKYWQLG-ZHACJKMWSA-N |
| SMILES | CCN(CC)CCOc1ccc(C=Cc2ccccc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:2551-76-0
CAS#:77257-42-2![diethyl-methyl-[2-[4-[(E)-2-phenylethenyl]phenoxy]ethyl]azanium,iodide structure](https://image.chemsrc.com/caspic/252/63977-65-1.png)
CAS#:63977-65-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(2-Diaethylamino-aethoxy)-trans-stilben |
| Diaethyl-[2-(trans-stilbenyl-(4)-oxy)-aethyl]-amin |
| 4-<2-Diaethylamino-aethoxy>-stilben |
| Triethylamine,2-(p-styrylphenoxy) |
| 2-(p-Styrylphenoxy)triethylamine |
| Ethanamine,N,N-diethyl-2-(4-(2-phenylethenyl)phenoxy) |
| diethyl-[2-(trans-stilbenyl-(4)-oxy)-ethyl]-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: InChIKey of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is BXEBFKORKYWQLG-ZHACJKMWSA-N. |
| Q: What is the boiling point of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: Boiling point of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is 428.7ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: Polar surface area (PSA) of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is 12.47000. |
| Q: What is the Chinese name of 73675-52-2? |
| A: Chinese name of 73675-52-2 is 73675-52-2. |
| Q: What are the downstream products of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: Related downstream products(CAS) of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine: 2551-76-0;77257-42-2;63977-65-1. |
| Q: What English synonyms does N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine have? |
| A: English synonyms of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine: 4-(2-Diaethylamino-aethoxy)-trans-stilben, Diaethyl-[2-(trans-stilbenyl-(4)-oxy)-aethyl]-amin, 4--stilben, Triethylamine,2-(p-styrylphenoxy), 2-(p-Styrylphenoxy)triethylamine, Ethanamine,N,N-diethyl-2-(4-(2-phenylethenyl)phenoxy), diethyl-[2-(trans-stilbenyl-(4)-oxy)-ethyl]-amine. |
| Q: What is the CAS number of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: CAS number of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is 73675-52-2. |
| Q: What is the molecular formula of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: Molecular formula of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is C20H25NO. |
| Q: What is the SMILES notation of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: SMILES notation of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is CCN(CC)CCOc1ccc(C=Cc2ccccc2)cc1. |
| Q: What is the English name of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine? |
| A: The English name of N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine is N,N-diethyl-2-[4-[(E)-2-phenylethenyl]phenoxy]ethanamine. |