DE(hydroxymethyl) ipratropium
Modify Date: 2025-08-27 22:42:23
DE(hydroxymethyl) ipratropium structure
|
Common Name | DE(hydroxymethyl) ipratropium | ||
|---|---|---|---|---|
| CAS Number | 736876-24-7 | Molecular Weight | 302.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28NO2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | DE(hydroxymethyl) ipratropium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H28NO2+ |
|---|---|
| Molecular Weight | 302.4 |
| InChIKey | PCCFHDBOHJFROM-ZVBHREPYSA-N |
| SMILES | CC(C)[N+]1(C)C2CCC1CC(OC(=O)Cc1ccccc1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of DE(hydroxymethyl) ipratropium? |
| A: Molecular weight of DE(hydroxymethyl) ipratropium is 302.4. |
| Q: What is the InChIKey of DE(hydroxymethyl) ipratropium? |
| A: InChIKey of DE(hydroxymethyl) ipratropium is PCCFHDBOHJFROM-ZVBHREPYSA-N. |
| Q: What is the English name of DE(hydroxymethyl) ipratropium? |
| A: The English name of DE(hydroxymethyl) ipratropium is DE(hydroxymethyl) ipratropium. |
| Q: What is the molecular formula of DE(hydroxymethyl) ipratropium? |
| A: Molecular formula of DE(hydroxymethyl) ipratropium is C19H28NO2+. |
| Q: What is the SMILES notation of DE(hydroxymethyl) ipratropium? |
| A: SMILES notation of DE(hydroxymethyl) ipratropium is CC(C)[N+]1(C)C2CCC1CC(OC(=O)Cc1ccccc1)C2. |
| Q: What is the Chinese name of 736876-24-7? |
| A: Chinese name of 736876-24-7 is 736876-24-7. |
| Q: What is the CAS number of DE(hydroxymethyl) ipratropium? |
| A: CAS number of DE(hydroxymethyl) ipratropium is 736876-24-7. |