1,2-Diaminonaphtahlene-5,7-disulfonic acid structure
|
Common Name | 1,2-Diaminonaphtahlene-5,7-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 73692-57-6 | Molecular Weight | 318.326 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-diaminonaphthalene-1,3-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O6S2 |
| Molecular Weight | 318.326 |
| Exact Mass | 317.998016 |
| PSA | 177.54000 |
| LogP | -1.20 |
| Index of Refraction | 1.771 |
| InChIKey | KHEHRJJAWUJGDW-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1N |
| Storage condition | 2-8℃ |
| HS Code | 2921590090 |
|---|
|
~%
1,2-Diaminonaph... CAS#:73692-57-6 |
| Literature: DE167139 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Diaminonaphtahlene-5,7-disulfonic acid |
| 5,6-Diamino-1,3-naphthalenedisulfonic acid |
| MFCD00272410 |
| 5,6-Diamino-naphthalin-1,3-disulfonsaeure |
| 5,6-diamino-naphthalene-1,3-disulfonic acid |
| 1,3-Naphthalenedisulfonic acid, 5,6-diamino- |
| 5,6-Diaminonaphthalene-1,3-disulfonic acid |
| EINECS 277-570-4 |
| Naphthylendiamin-(1.2)-disulfonsaeure-(5.7) |
| 5,6-Diaminonaphthalene-1,3-disulphonic acid |
| 1,2-Diaminonaphthalene-5,7-disulfonic acid |