(1Z,3E)-1,3-bis(3-methyl-1,3-thiazolidin-2-ylidene)urea structure
|
Common Name | (1Z,3E)-1,3-bis(3-methyl-1,3-thiazolidin-2-ylidene)urea | ||
|---|---|---|---|---|
| CAS Number | 73696-64-7 | Molecular Weight | 258.36400 | |
| Density | 1.46g/cm3 | Boiling Point | 392.4ºC at 760 mmHg | |
| Molecular Formula | C9H14N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1ºC | |
| Name | (1Z,3E)-1,3-bis(3-methyl-1,3-thiazolidin-2-ylidene)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760 mmHg |
| Molecular Formula | C9H14N4OS2 |
| Molecular Weight | 258.36400 |
| Flash Point | 191.1ºC |
| Exact Mass | 258.06100 |
| PSA | 98.87000 |
| LogP | 1.05140 |
| Index of Refraction | 1.713 |
| InChIKey | AMMFKJOJHJQCGY-PNQPDEHRSA-N |
| SMILES | CN1CCSC1=NC(=O)N=C1SCCN1C |
|
~26%
(1Z,3E)-1,3-bis... CAS#:73696-64-7 |
| Literature: Rokach; Girard; Hamel; Reader; Rooney; Mandel; Cragoe Jr.; Zacchei Journal of Medicinal Chemistry, 1980 , vol. 23, # 7 p. 773 - 780 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Urea,1,3-bis(3-methyl-2-thiazolidinylidene) |
| N,N'-Bis(3-methyl-2-thiazolidinylidene)urea |