Benzenesulfonamide,N-(3-bromopropyl)-4-methyl-N-phenyl- structure
|
Common Name | Benzenesulfonamide,N-(3-bromopropyl)-4-methyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 737-14-4 | Molecular Weight | 368.28900 | |
| Density | 1.418g/cm3 | Boiling Point | 470.1ºC at 760 mmHg | |
| Molecular Formula | C16H18BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | N-(3-bromopropyl)-4-methyl-N-phenylbenzenesulfonamide |
|---|
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 470.1ºC at 760 mmHg |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.28900 |
| Flash Point | 238.1ºC |
| Exact Mass | 367.02400 |
| PSA | 45.76000 |
| LogP | 5.05610 |
| Index of Refraction | 1.613 |
| InChIKey | MPNVXJNVUADUDJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCBr)c2ccccc2)cc1 |
|
~%
Benzenesulfonam... CAS#:737-14-4 |
| Literature: Braunholtz; Mann Journal of the Chemical Society, 1957 , p. 4174,4179 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |