4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)
4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) structure
|
Common Name | 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 73717-80-3 | Molecular Weight | 232.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) (CAS: 73717-80-3, molecular formula: C12H12N2OS, molecular weight: 232.30100), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2OS |
|---|---|
| Molecular Weight | 232.30100 |
| Exact Mass | 232.06700 |
| PSA | 71.05000 |
| LogP | 2.08260 |
| InChIKey | YFSCDOVCYRSTTN-UHFFFAOYSA-N |
| SMILES | CSc1ncc(Cc2ccccc2)c(=O)[nH]1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![5-benzyl-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one,dihydrochloride structure](https://image.chemsrc.com/caspic/019/116608-81-2.png)
CAS#:116608-81-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Benzyl-2-(methylthio)pyrimidin-4(3H)-one |
| 5-Benzyl-2-methylthio-4-pyrimidinon |
| Diazolinum |
| MEBHYDROLINE NAPADISYLATE |
| 5-benzyl-2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole,naphthalene-1,5-disulfonate |
| omeril |
| DIAZOLINE |
| MEBBYDROLIN NAPADISYLATE |
| incidal |
| Diazolinum: Mebhydrolin |
| diazolin |
| 5-Benzyl-2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol,Naphthalin-1,5-disulfonat |
| mebhydrolin napadisilate |
| 2-(methylthio)-5-(phenylmethyl)-4 (3H)-pyrimidinone |
| 5-Benzyl-2-methylmercapto-3H-pyrimidin-4-on |
| 5-benzyl-2-methylsulfanyl-3H-pyrimidin-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 73717-80-3? |
| A: Chinese name of 73717-80-3 is 73717-80-3. |
| Q: What is the InChIKey of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: InChIKey of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is YFSCDOVCYRSTTN-UHFFFAOYSA-N. |
| Q: What is the LogP of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: LogP of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is 2.08260. |
| Q: What are the downstream products of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: Related downstream products(CAS) of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl): 116608-81-2. |
| Q: What is the molecular formula of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: Molecular formula of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is C12H12N2OS. |
| Q: What is the polar surface area (PSA) of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: Polar surface area (PSA) of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is 71.05000. |
| Q: What is the SMILES notation of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: SMILES notation of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is CSc1ncc(Cc2ccccc2)c(=O)[nH]1. |
| Q: What is the CAS number of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: CAS number of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is 73717-80-3. |
| Q: What is the molecular weight of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: Molecular weight of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is 232.30100. |
| Q: What is the English name of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl)? |
| A: The English name of 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl) is 4(1H)-Pyrimidinone, 2-(methylthio)-5-(phenylmethyl). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |