toluene-2,4,6-triyl triisocyanate
Modify Date: 2025-08-25 08:42:16
toluene-2,4,6-triyl triisocyanate structure
|
Common Name | toluene-2,4,6-triyl triisocyanate | ||
|---|---|---|---|---|
| CAS Number | 7373-26-4 | Molecular Weight | 215.16500 | |
| Density | 1.26g/cm3 | Boiling Point | 328ºC at 760 mmHg | |
| Molecular Formula | C10H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4ºC | |
| Name | 1,3,5-triisocyanato-2-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 328ºC at 760 mmHg |
| Molecular Formula | C10H5N3O3 |
| Molecular Weight | 215.16500 |
| Flash Point | 134.4ºC |
| Exact Mass | 215.03300 |
| PSA | 88.29000 |
| LogP | 1.89690 |
| Index of Refraction | 1.592 |
| InChIKey | PFUKECZPRROVOD-UHFFFAOYSA-N |
| SMILES | Cc1c(N=C=O)cc(N=C=O)cc1N=C=O |
| HS Code | 2929109000 |
|---|
|
~%
toluene-2,4,6-t... CAS#:7373-26-4 |
| Literature: Gill; MacGillivray; Munro Journal of the Chemical Society, 1949 , p. 1753 Show Details Siefken Justus Liebigs Annalen der Chemie, 1949 , vol. 562, p. 75,1114 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![ethyl N-[3,5-bis(ethoxycarbonylamino)-2-methyl-phenyl]carbamate structure](https://image.chemsrc.com/caspic/204/7401-92-5.png)
CAS#:7401-92-5| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 230-932-5 |
| 2-Methyl-benzen-1,3,5-triyltriisocyanat |
| 2.4.6-Triisocyanato-toluol |
| 2,4,6-tri-isocyanatotoluene |
| 1,3,5-triisocyanato-2-methyl-benzene |
| Toluene-2,4,6-triyl triisocyanate |
| 2-methyl-benzene-1,3,5-triyl triisocyanate |