(Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate
Modify Date: 2025-11-06 14:31:02
(Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate structure
|
Common Name | (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 73733-73-0 | Molecular Weight | 276.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O2S |
|---|---|
| Molecular Weight | 276.36 |
| InChIKey | SGZYDLOOPYIQFM-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCC(N=C=S)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: Molecular weight of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is 276.36. |
| Q: What is the CAS number of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: CAS number of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is 73733-73-0. |
| Q: What is the Chinese name of 73733-73-0? |
| A: Chinese name of 73733-73-0 is 73733-73-0. |
| Q: What is the SMILES notation of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: SMILES notation of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is O=C(OCc1ccccc1)N1CCC(N=C=S)CC1. |
| Q: What is the InChIKey of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: InChIKey of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is SGZYDLOOPYIQFM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: Molecular formula of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is C14H16N2O2S. |
| Q: What is the English name of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate? |
| A: The English name of (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate is (Phenylmethyl) 4-isothiocyanato-1-piperidinecarboxylate. |