2,2'-(1,4-Phenylene)bis(2-chloropropane)
2,2'-(1,4-Phenylene)bis(2-chloropropane) structure
|
Common Name | 2,2'-(1,4-Phenylene)bis(2-chloropropane) | ||
|---|---|---|---|---|
| CAS Number | 7374-80-3 | Molecular Weight | 231.16100 | |
| Density | 1.087g/cm3 | Boiling Point | 294.9ºC at 760 mmHg | |
| Molecular Formula | C12H16Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4ºC | |
Summary: 1,4-Bis(2-chloropropan-2-yl)benzene (also known as 2,2'-(1,4-Phenylene)bis(2-chloropropane)), CAS: 7374-80-3, molecular formula: C12H16Cl2, molecular weight: 231.16100, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-bis(2-chloropropan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 294.9ºC at 760 mmHg |
| Molecular Formula | C12H16Cl2 |
| Molecular Weight | 231.16100 |
| Flash Point | 144.4ºC |
| Exact Mass | 230.06300 |
| LogP | 4.63440 |
| Index of Refraction | 1.508 |
| InChIKey | GWRGEEAABGHXBR-UHFFFAOYSA-N |
| SMILES | CC(C)(Cl)c1ccc(C(C)(C)Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~44%
2,2'-(1,4-Pheny... CAS#:7374-80-3 |
| Literature: KANEKA CORPORATION Patent: EP1553072 A1, 2005 ; Location in patent: Page/Page column 11-12 ; |
|
~%
2,2'-(1,4-Pheny... CAS#:7374-80-3 |
| Literature: Mitin Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 3302,3306; engl. Ausg. S. 3328, 3331 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1605-18-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-(2-chloro-2-propyl)benzene |
| 1,4-Bis(1-chloro-1-methylethyl)benzene |
| Benzene,1,4-bis(1-chloro-1-methylethyl) |
| para-cumyl chloride |
| 1,4-Bis(2-chloroisopropyl)benzene |
| 1,4-bis(2-chloro-2-propyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7374-80-3? |
| A: Chinese name of 7374-80-3 is 7374-80-3. |
| Q: What is the CAS number of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: CAS number of 1,4-bis(2-chloropropan-2-yl)benzene is 7374-80-3. |
| Q: What is the molecular formula of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: Molecular formula of 1,4-bis(2-chloropropan-2-yl)benzene is C12H16Cl2. |
| Q: What are the upstream materials of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: Related upstream materials(CAS) of 1,4-bis(2-chloropropan-2-yl)benzene: 100-18-5;2948-46-1. |
| Q: What English synonyms does 1,4-bis(2-chloropropan-2-yl)benzene have? |
| A: English synonyms of 1,4-bis(2-chloropropan-2-yl)benzene: 1,4-(2-chloro-2-propyl)benzene, 1,4-Bis(1-chloro-1-methylethyl)benzene, Benzene,1,4-bis(1-chloro-1-methylethyl), para-cumyl chloride, 1,4-Bis(2-chloroisopropyl)benzene, 1,4-bis(2-chloro-2-propyl)benzene. |
| Q: What is the LogP of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: LogP of 1,4-bis(2-chloropropan-2-yl)benzene is 4.63440. |
| Q: What is the InChIKey of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: InChIKey of 1,4-bis(2-chloropropan-2-yl)benzene is GWRGEEAABGHXBR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: Molecular weight of 1,4-bis(2-chloropropan-2-yl)benzene is 231.16100. |
| Q: What is the English name of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: The English name of 1,4-bis(2-chloropropan-2-yl)benzene is 1,4-bis(2-chloropropan-2-yl)benzene. |
| Q: What is the SMILES notation of 1,4-bis(2-chloropropan-2-yl)benzene? |
| A: SMILES notation of 1,4-bis(2-chloropropan-2-yl)benzene is CC(C)(Cl)c1ccc(C(C)(C)Cl)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |