9-bromo-3-nitro-9H-fluorene
Modify Date: 2025-08-26 06:48:34
9-bromo-3-nitro-9H-fluorene structure
|
Common Name | 9-bromo-3-nitro-9H-fluorene | ||
|---|---|---|---|---|
| CAS Number | 73748-71-7 | Molecular Weight | 290.11200 | |
| Density | 1.662g/cm3 | Boiling Point | 413.9ºC at 760 mmHg | |
| Molecular Formula | C13H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.1ºC | |
| Name | 9-bromo-3-nitro-9H-fluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Boiling Point | 413.9ºC at 760 mmHg |
| Molecular Formula | C13H8BrNO2 |
| Molecular Weight | 290.11200 |
| Flash Point | 204.1ºC |
| Exact Mass | 288.97400 |
| PSA | 45.82000 |
| LogP | 4.58270 |
| Index of Refraction | 1.709 |
| InChIKey | PXCXOASDSANYOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-c1ccccc1C2Br |
| HS Code | 2904909090 |
|---|
|
~98%
9-bromo-3-nitro... CAS#:73748-71-7 |
| Literature: Pan; Cole; Fletcher Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 1 p. 122 - 123 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9-bromo-3-nitrofluorene |