2,4-diacetylaminobenzoic acid
Modify Date: 2025-11-25 14:51:00
2,4-diacetylaminobenzoic acid structure
|
Common Name | 2,4-diacetylaminobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 73748-78-4 | Molecular Weight | 236.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-diacetylaminobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O4 |
|---|---|
| Molecular Weight | 236.22400 |
| Exact Mass | 236.08000 |
| PSA | 95.50000 |
| LogP | 1.44760 |
| InChIKey | UZGYKGBZSGOYCM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)O)c(NC(C)=O)c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:611-03-0|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 2,4-bis-acetylamino-benzoic acid |
| 2,4-Bis-acetylamino-benzoesaeure |
| 2.4-Bis-acetamino-benzoesaeure |
| 2.4-Diacetylamino-benzoesaeure |
| 2,4-Diacetylamino-benzoesaeure |