Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl
![Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl Structure](https://image.chemsrc.com/caspic/271/737792-27-7.png)
Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl structure
|
Common Name | Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 737792-27-7 | Molecular Weight | 287.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl (CAS: 737792-27-7, molecular formula: C11H12Cl2N4O, molecular weight: 287.145), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12Cl2N4O |
|---|---|
| Molecular Weight | 287.14500 |
| Exact Mass | 286.03900 |
| PSA | 70.67000 |
| LogP | 3.32230 |
| InChIKey | UYAKRWBRYYVYLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1nc(Cl)c2c(Cl)c[nH]c2n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
Propanamide, N-... CAS#:737792-27-7 |
| Literature: Seela, Frank; Peng, Xiaohua Synthesis, 2004 , # 8 p. 1203 - 1210 |
|
~%
Propanamide, N-... CAS#:737792-27-7 |
| Literature: Seela, Frank; Peng, Xiaohua Synthesis, 2004 , # 8 p. 1203 - 1210 |
|
~%
Propanamide, N-... CAS#:737792-27-7 |
| Literature: Seela, Frank; Peng, Xiaohua Synthesis, 2004 , # 8 p. 1203 - 1210 |
![N-(4-Chloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethylpropionamide structure](https://image.chemsrc.com/caspic/389/149765-15-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-dichloro-2-pivaloylamino-7H-pyrrolo[2,3-d]pyrimidine |
| 4,5-Dichloro-2,3-dihydro-2-phenylpyridazin-3-one |
| 1-Phenyl-4,5-dichloro-6-pyridazone |
| 2-phenyl-4,5-dichloro-3(2H)-pyridazinone |
| 4,5-dichloro-2-phenyl-2H-pyridazin-3-one |
| 4,5-dichloro-2-phenylpyridazin-3(2H)-one |
| 2-phenyl-4,5-dichloropyridazin-3-one |
| 4,5-dichloro-2-pivalamido-7H-pyrrolo[2,3-d]pyrimidine |
| 4,5-Dichloro-2-phenyl-3(2H)-pyridazinone |
| 4,5-dichloro-1-phenylpyridazin-6-one |
| 1-Fenyl-4,5-dichlor-6-pyridazinon |
| 3(2H)-Pyridazinone,4,5-dichloro-2-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: Molecular weight of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is 287.14500. |
| Q: What is the Chinese name of 737792-27-7? |
| A: Chinese name of 737792-27-7 is 737792-27-7. |
| Q: What is the English name of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: The English name of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl. |
| Q: What is the SMILES notation of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: SMILES notation of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is CC(C)(C)C(=O)Nc1nc(Cl)c2c(Cl)c[nH]c2n1. |
| Q: What is the InChIKey of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: InChIKey of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is UYAKRWBRYYVYLD-UHFFFAOYSA-N. |
| Q: What is the LogP of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: LogP of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is 3.32230. |
| Q: What is the polar surface area (PSA) of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: Polar surface area (PSA) of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is 70.67000. |
| Q: What are the upstream materials of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: Related upstream materials(CAS) of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl: 149765-15-1;3282-30-2;84955-31-7. |
| Q: What is the molecular formula of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: Molecular formula of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is C11H12Cl2N4O. |
| Q: What is the CAS number of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl? |
| A: CAS number of Propanamide, N-(4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethyl is 737792-27-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |