(+/-)-1,2-DIDECANOYLGLYCEROL structure
|
Common Name | (+/-)-1,2-DIDECANOYLGLYCEROL | ||
|---|---|---|---|---|
| CAS Number | 73799-06-1 | Molecular Weight | 334.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (+/-)11(12)-epetre methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H34O3 |
|---|---|
| Molecular Weight | 334.49300 |
| Exact Mass | 334.25100 |
| PSA | 38.83000 |
| LogP | 5.51630 |
| InChIKey | DHUPCTVGLDZJCY-LFCLFRSTSA-N |
| SMILES | CCCCCC=CCC1OC1CC=CCC=CCCCC(=O)OC |
|
~%
(+/-)-1,2-DIDEC... CAS#:73799-06-1 |
| Literature: Corey; Marfat; Falck; Albright Journal of the American Chemical Society, 1980 , vol. 102, # 4 p. 1433 - 1435 |
|
~%
(+/-)-1,2-DIDEC... CAS#:73799-06-1 |
| Literature: Corey; Marfat; Falck; Albright Journal of the American Chemical Society, 1980 , vol. 102, # 4 p. 1433 - 1435 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 11,12-eet methyl ester |