1,2,3,4-tetramethyl-5-[(2,3,4,5-tetramethylphenyl)methyl]benzene structure
|
Common Name | 1,2,3,4-tetramethyl-5-[(2,3,4,5-tetramethylphenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 738-47-6 | Molecular Weight | 280.44700 | |
| Density | 0.937g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C21H28 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 1,2,3,4-tetramethyl-5-[(2,3,4,5-tetramethylphenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.937g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.44700 |
| Flash Point | 226.5ºC |
| Exact Mass | 280.21900 |
| LogP | 5.74460 |
| Index of Refraction | 1.542 |
| InChIKey | JHGODABHTOBMFT-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)c(C)c(C)c2C)c(C)c(C)c1C |
|
~%
1,2,3,4-tetrame... CAS#:738-47-6 |
| Literature: Welch; Smith Journal of the American Chemical Society, 1951 , vol. 73, p. 4391 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,3,4,5,3',4'5'-Octamethyl-diphenylmethan |
| 2,2',3,3',4,4',5,5'-Octamethyl-diphenylmethan |