4-[(4-dimethylaminophenyl)iminomethylideneamino]-N,N-dimethyl-aniline structure
|
Common Name | 4-[(4-dimethylaminophenyl)iminomethylideneamino]-N,N-dimethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 738-65-8 | Molecular Weight | 280.36800 | |
| Density | 1.01g/cm3 | Boiling Point | 457.4ºC at 760 mmHg | |
| Molecular Formula | C17H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | 4-[[4-(dimethylamino)phenyl]iminomethylideneamino]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760 mmHg |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.36800 |
| Flash Point | 230.4ºC |
| Exact Mass | 280.16900 |
| PSA | 31.20000 |
| LogP | 3.95570 |
| Index of Refraction | 1.556 |
| InChIKey | ABFDTYJJUSUWRB-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=C=Nc2ccc(N(C)C)cc2)cc1 |
|
~%
4-[(4-dimethyla... CAS#:738-65-8 |
| Literature: Zetzsche; Nerger Chemische Berichte, 1940 , vol. 73, p. 467,476 |
|
~%
4-[(4-dimethyla... CAS#:738-65-8 |
| Literature: Cohen,S.C.; Khedouri,E. Journal of the American Chemical Society, 1961 , vol. 83, p. 4228 - 4233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-(4-dimethylamino-phenyl)-carbodiimid |
| 1,3-Bis-(4-dimethylamino-phenyl)-carbodiimid |
| bis-(4-dimethylamino-phenyl)-carbodiimide |
| Bis(p-dimethylaminophenyl)carbodiimide |
| Di-p-Dimethylaminophenylcarbodiimide |
| Di-p-Diethylaminophenylcarbodiimide |