(1S,8aα)-2,3,3a,5,6,7,8,8a-Octahydro-3aα-methyl-7-methylene-1α-(1-methylethyl)azulen-4(1H)-one
(1S,8aα)-2,3,3a,5,6,7,8,8a-Octahydro-3aα-methyl-7-methylene-1α-(1-methylethyl)azulen-4(1H)-one structure
|
Common Name | (1S,8aα)-2,3,3a,5,6,7,8,8a-Octahydro-3aα-methyl-7-methylene-1α-(1-methylethyl)azulen-4(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 73809-82-2 | Molecular Weight | 220.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | salvial-4(14)-en-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24O |
|---|---|
| Molecular Weight | 220.35000 |
| Exact Mass | 220.18300 |
| PSA | 17.07000 |
| LogP | 3.98410 |
| InChIKey | JBOONPKUPONSIB-KCQAQPDRSA-N |
| SMILES | C=C1CCC(=O)C2(C)CCC(C(C)C)C2C1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:6750-60-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of salvial-4(14)-en-1-one? |
| A: Polar surface area (PSA) of salvial-4(14)-en-1-one is 17.07000. |
| Q: What is the SMILES notation of salvial-4(14)-en-1-one? |
| A: SMILES notation of salvial-4(14)-en-1-one is C=C1CCC(=O)C2(C)CCC(C(C)C)C2C1. |
| Q: What is the molecular weight of salvial-4(14)-en-1-one? |
| A: Molecular weight of salvial-4(14)-en-1-one is 220.35000. |
| Q: What are the downstream products of salvial-4(14)-en-1-one? |
| A: Related downstream products(CAS) of salvial-4(14)-en-1-one: 6750-60-3. |
| Q: What is the CAS number of salvial-4(14)-en-1-one? |
| A: CAS number of salvial-4(14)-en-1-one is 73809-82-2. |
| Q: What is the molecular formula of salvial-4(14)-en-1-one? |
| A: Molecular formula of salvial-4(14)-en-1-one is C15H24O. |
| Q: What is the LogP of salvial-4(14)-en-1-one? |
| A: LogP of salvial-4(14)-en-1-one is 3.98410. |
| Q: What is the English name of salvial-4(14)-en-1-one? |
| A: The English name of salvial-4(14)-en-1-one is salvial-4(14)-en-1-one. |
| Q: What is the InChIKey of salvial-4(14)-en-1-one? |
| A: InChIKey of salvial-4(14)-en-1-one is JBOONPKUPONSIB-KCQAQPDRSA-N. |
| Q: What is the Chinese name of 73809-82-2? |
| A: Chinese name of 73809-82-2 is 73809-82-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |