1,2-disodiostilbene
1,2-disodiostilbene structure
|
Common Name | 1,2-disodiostilbene | ||
|---|---|---|---|---|
| CAS Number | 7381-15-9 | Molecular Weight | 226.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Na2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-disodiostilbene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12Na2 |
|---|---|
| Molecular Weight | 226.22500 |
| Exact Mass | 226.07300 |
| LogP | 3.75860 |
| InChIKey | VDVJSZACBJWSLB-UHFFFAOYSA-N |
| SMILES | [Na+].[Na+].c1ccc([CH-][CH-]c2ccccc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:645-49-8
CAS#:4180-23-8
CAS#:103-30-0
CAS#:112-38-9
CAS#:112-43-6
CAS#:65-85-0
CAS#:632-51-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-diphenyl-1,2-disodioethane |
| bibenzyl-α,α'-diyl disodium |
| Bibenzyl-α,α'-diyldinatrium |
| 1,2-diphenyl-1,2-disodiumethane |
| 1.2-Dinatrium-1.2-diphenyl-aethan |
| Dinatriumstilben |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1,2-disodiostilbene have? |
| A: English synonyms of 1,2-disodiostilbene: 1,2-diphenyl-1,2-disodioethane, bibenzyl-α,α'-diyl disodium, Bibenzyl-α,α'-diyldinatrium, 1,2-diphenyl-1,2-disodiumethane, 1.2-Dinatrium-1.2-diphenyl-aethan, Dinatriumstilben. |
| Q: What is the CAS number of 1,2-disodiostilbene? |
| A: CAS number of 1,2-disodiostilbene is 7381-15-9. |
| Q: What is the English name of 1,2-disodiostilbene? |
| A: The English name of 1,2-disodiostilbene is 1,2-disodiostilbene. |
| Q: What is the InChIKey of 1,2-disodiostilbene? |
| A: InChIKey of 1,2-disodiostilbene is VDVJSZACBJWSLB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,2-disodiostilbene? |
| A: Molecular weight of 1,2-disodiostilbene is 226.22500. |
| Q: What is the SMILES notation of 1,2-disodiostilbene? |
| A: SMILES notation of 1,2-disodiostilbene is [Na+].[Na+].c1ccc([CH-][CH-]c2ccccc2)cc1. |
| Q: What is the molecular formula of 1,2-disodiostilbene? |
| A: Molecular formula of 1,2-disodiostilbene is C14H12Na2. |
| Q: What is the LogP of 1,2-disodiostilbene? |
| A: LogP of 1,2-disodiostilbene is 3.75860. |
| Q: What are the downstream products of 1,2-disodiostilbene? |
| A: Related downstream products(CAS) of 1,2-disodiostilbene: 645-49-8;4180-23-8;103-30-0;112-38-9;112-43-6;65-85-0;632-51-9. |
| Q: What is the Chinese name of 7381-15-9? |
| A: Chinese name of 7381-15-9 is 7381-15-9. |