1,2-Oxathiin-4-amine,3,4-dihydro-N,N,5,6-tetramethyl-, 2,2-dioxide structure
|
Common Name | 1,2-Oxathiin-4-amine,3,4-dihydro-N,N,5,6-tetramethyl-, 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 73813-08-8 | Molecular Weight | 205.27500 | |
| Density | 1.21g/cm3 | Boiling Point | 313.8ºC at 760mmHg | |
| Molecular Formula | C8H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.6ºC | |
| Name | N,N,5,6-tetramethyl-2,2-dioxo-3,4-dihydrooxathiin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 313.8ºC at 760mmHg |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.27500 |
| Flash Point | 143.6ºC |
| Exact Mass | 205.07700 |
| PSA | 54.99000 |
| LogP | 1.65130 |
| Index of Refraction | 1.515 |
| InChIKey | CQHWEDWERYTTDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(N(C)C)CS(=O)(=O)O1 |
|
~48%
1,2-Oxathiin-4-... CAS#:73813-08-8 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 33 - 37 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Dimethylamino-3,4-dihydro-5,6-dimethyl-1,2-oxathiin 2,2-Dioxide |