5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide structure
|
Common Name | 5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 73813-10-2 | Molecular Weight | 247.31100 | |
| Density | 1.264g/cm3 | Boiling Point | 387.7ºC at 760 mmHg | |
| Molecular Formula | C10H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.3ºC | |
| Name | 5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 387.7ºC at 760 mmHg |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.31100 |
| Flash Point | 188.3ºC |
| Exact Mass | 247.08800 |
| PSA | 64.22000 |
| LogP | 1.35980 |
| Index of Refraction | 1.524 |
| InChIKey | VUISNAZBZKLQAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(N2CCOCC2)CS(=O)(=O)O1 |
|
~33%
5,6-dimethyl-4-... CAS#:73813-10-2 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 33 - 37 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(5,6-Dimethyl-2,2-dioxido-3,4-dihydro-1,2-oxathiin-4-yl)morpholine |