3,10,22,23,24-Pentaoxa-17-thiatetracyclo[17.2.1.15,8.112,15]tetracosa-5,7,12,14,19,21(1)-hexene-2,11-dione structure
|
Common Name | 3,10,22,23,24-Pentaoxa-17-thiatetracyclo[17.2.1.15,8.112,15]tetracosa-5,7,12,14,19,21(1)-hexene-2,11-dione | ||
|---|---|---|---|---|
| CAS Number | 73823-25-3 | Molecular Weight | 374.36500 | |
| Density | 1.344g/cm3 | Boiling Point | 686.9ºC at 760 mmHg | |
| Molecular Formula | C18H14O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.2ºC | |
| Name | brn 1668346 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 686.9ºC at 760 mmHg |
| Molecular Formula | C18H14O7S |
| Molecular Weight | 374.36500 |
| Flash Point | 369.2ºC |
| Exact Mass | 374.04600 |
| PSA | 117.32000 |
| LogP | 3.92640 |
| Index of Refraction | 1.559 |
| InChIKey | FDZUDEZWGWAKSJ-UHFFFAOYSA-N |
| SMILES | O=C1OCc2ccc(o2)COC(=O)c2ccc(o2)CSCc2ccc1o2 |
| 2-Furoic acid,5,5'-thiodimethylene-,cyclic ester with 2,5-furandimethanol |
| 3,10,22,23,24-Pentaoxa-17-thiatetracyclo(17.2.1.1(sup 5,8).1(sup 12,15))tetracosa-5,7,12,14,19,21-hexaene-2,11-dione |