1-(4-Chloro-1-naphtyloxy)-2-propanone structure
|
Common Name | 1-(4-Chloro-1-naphtyloxy)-2-propanone | ||
|---|---|---|---|---|
| CAS Number | 73826-08-1 | Molecular Weight | 234.67800 | |
| Density | 1.237g/cm3 | Boiling Point | 374.1ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 1-(4-chloronaphthalen-1-yl)oxypropan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760 mmHg |
| Molecular Formula | C13H11ClO2 |
| Molecular Weight | 234.67800 |
| Flash Point | 158.3ºC |
| Exact Mass | 234.04500 |
| PSA | 26.30000 |
| LogP | 3.46100 |
| Index of Refraction | 1.601 |
| InChIKey | KWCQQFPVMBVHRK-UHFFFAOYSA-N |
| SMILES | CC(=O)COc1ccc(Cl)c2ccccc12 |
|
~%
1-(4-Chloro-1-n... CAS#:73826-08-1 |
| Literature: Hunter,W.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 167 - 174 |
| 2-Propanone,1-(4-chloro-1-naphthyloxy) |
| 1-(4-Chloro-1-naphthyloxy)-2-propanone |