diethyl-methyl-[2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)ethyl]azanium,diiodide structure
|
Common Name | diethyl-methyl-[2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)ethyl]azanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 73826-53-6 | Molecular Weight | 508.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H34I2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-methyl-[2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)ethyl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H34I2N2 |
|---|---|
| Molecular Weight | 508.26400 |
| Exact Mass | 508.08100 |
| InChIKey | RMSMATYJKXEQST-UHFFFAOYSA-L |
| SMILES | CC[N+](C)(CC)CC[N+]1(C)CC2CCCCC2C1.[I-].[I-] |
|
~%
diethyl-methyl-... CAS#:73826-53-6 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-{2-[diethyl(methyl)ammonio]ethyl}-2-methyloctahydro-1H-isoindolium diiodide |
| diethyl-methyl-[2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)ethyl]azanium diiodide |
| 2-(2-(Diethylmethylammonium)ethyl)-2-methylhexahydroisoindolinium diiodide |
| ISOINDOLINIUM,HEXAHYDRO-2-(2-(DIETHYLMETHYLAMMONIO)ETHYL)-2-METHYL-,DIIODIDE |
| 8-(Diethylmethylammoniumethyl)-8-methyl-8-azoniumbicyclo-(4.3.0)nonane diiodide |