4-ethoxy-2,6-dimethyl-1-oxidopyrimidin-1-ium structure
|
Common Name | 4-ethoxy-2,6-dimethyl-1-oxidopyrimidin-1-ium | ||
|---|---|---|---|---|
| CAS Number | 73833-06-4 | Molecular Weight | 168.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxy-2,6-dimethyl-1-oxidopyrimidin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H12N2O2 |
|---|---|
| Molecular Weight | 168.19300 |
| Exact Mass | 168.09000 |
| PSA | 47.58000 |
| LogP | 1.52560 |
| InChIKey | JJBHJDGHNIKRRK-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C)[n+]([O-])c(C)n1 |
|
~%
4-ethoxy-2,6-di... CAS#:73833-06-4 |
| Literature: Yamanaka; Ogawa; Konno Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 98 - 104 |
|
~%
4-ethoxy-2,6-di... CAS#:73833-06-4 |
| Literature: Yamanaka; Ogawa; Konno Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 98 - 104 |
|
~82%
4-ethoxy-2,6-di... CAS#:73833-06-4 |
| Literature: L'Oreal Patent: US5438058 A1, 1995 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dimethyl-6-ethoxypyrimidine 3-oxide |
| Pyrimidine,4-ethoxy-2,6-dimethyl-,1-oxide |
| 4-ethoxy-2,6-dimethyl-pyrimidine 1-oxide |