2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol structure
|
Common Name | 2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 7384-94-3 | Molecular Weight | 246.34800 | |
| Density | 1.107g/cm3 | Boiling Point | 431.9ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215ºC | |
| Name | 2-[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760 mmHg |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.34800 |
| Flash Point | 215ºC |
| Exact Mass | 246.17300 |
| PSA | 39.26000 |
| LogP | 2.41310 |
| Index of Refraction | 1.603 |
| InChIKey | WQDZBGYWISXSQQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCO)CCc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(N-(2-(3-Indolyl)ethyl)-N-isopropylamino)ethanol |
| 2-[(2-indol-3-yl-ethyl)-isopropyl-amino]-ethanol |
| Indole,2-(N-(2-hydroxyethyl)-N-isopropylamino)ethyl |
| (2-Hydroxy-ethyl)-isopropyl-<2-(3-indolyl)-ethyl>-amin |
| ETHANOL,2-(N-(2-(3-INDOLYL)ETHYL)-N-ISOPROPYLAMINO) |
| 2-(N-(2-Hydroxyethyl)-N-isopropylamino)ethylindole |