2,2'-dithiobis(N-2-hydroxypropylbenzamide) structure
|
Common Name | 2,2'-dithiobis(N-2-hydroxypropylbenzamide) | ||
|---|---|---|---|---|
| CAS Number | 73845-37-1 | Molecular Weight | 420.54600 | |
| Density | 1.34g/cm3 | Boiling Point | 685.5ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368.4ºC | |
| Name | N-(2-hydroxypropyl)-2-[[2-(2-hydroxypropylcarbamoyl)phenyl]disulfanyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 685.5ºC at 760 mmHg |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.54600 |
| Flash Point | 368.4ºC |
| Exact Mass | 420.11800 |
| PSA | 156.24000 |
| LogP | 3.85680 |
| Index of Refraction | 1.657 |
| InChIKey | ODUBEYQKYAQFNS-UHFFFAOYSA-N |
| SMILES | CC(O)CNC(=O)c1ccccc1SSc1ccccc1C(=O)NCC(C)O |
|
~83%
2,2'-dithiobis(... CAS#:73845-37-1 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
|
~%
2,2'-dithiobis(... CAS#:73845-37-1 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
| Benzamide,2,2'-dithiobis(N-(2-hydroxypropyl) |
| 2,2'-dithiobis-<N-(2-hydroxypropyl)benzamide> |
| 2,2'-disulfanediylbis[n-(2-hydroxypropyl)benzamide] |
| KF-4939 |