5-(allylthio)-4-amino-9-(β-D-ribofuranosyl)pyrrolo<2,3-d:5,4-d'>dipyrimidine structure
|
Common Name | 5-(allylthio)-4-amino-9-(β-D-ribofuranosyl)pyrrolo<2,3-d:5,4-d'>dipyrimidine | ||
|---|---|---|---|---|
| CAS Number | 73851-45-3 | Molecular Weight | 390.41700 | |
| Density | 1.82g/cm3 | Boiling Point | 672.4ºC at 760 mmHg | |
| Molecular Formula | C16H18N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.5ºC | |
| Name | 5-(allylthio)-4-amino-9-(β-D-ribofuranosyl)pyrrolo<2,3-d:5,4-d'>dipyrimidine |
|---|
| Density | 1.82g/cm3 |
|---|---|
| Boiling Point | 672.4ºC at 760 mmHg |
| Molecular Formula | C16H18N6O4S |
| Molecular Weight | 390.41700 |
| Flash Point | 360.5ºC |
| Exact Mass | 390.11100 |
| PSA | 177.73000 |
| LogP | 0.42750 |
| Index of Refraction | 1.849 |
| InChIKey | LANPVQQSSISUGN-UHFFFAOYSA-N |
| SMILES | C=CCSc1ncnc2c1c1c(N)ncnc1n2C1OC(CO)C(O)C1O |
|
~63%
5-(allylthio)-4... CAS#:73851-45-3 |
| Literature: Chung, Fung-Lung; Schram, Karl H.; Panzica, Raymond P.; Earl, Robert A.; Wotring, Linda L.; Townsend, Leroy B. Journal of Medicinal Chemistry, 1980 , vol. 23, # 11 p. 1158 - 1166 |
|
~%
5-(allylthio)-4... CAS#:73851-45-3 |
| Literature: Chung, Fung-Lung; Schram, Karl H.; Panzica, Raymond P.; Earl, Robert A.; Wotring, Linda L.; Townsend, Leroy B. Journal of Medicinal Chemistry, 1980 , vol. 23, # 11 p. 1158 - 1166 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |