1,4-dihydroquinoxaline-2,3-dithione,pyrrolidine structure
|
Common Name | 1,4-dihydroquinoxaline-2,3-dithione,pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 73855-44-4 | Molecular Weight | 265.39800 | |
| Density | N/A | Boiling Point | 333.6ºC at 760 mmHg | |
| Molecular Formula | C12H15N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.6ºC | |
| Name | 1,4-dihydroquinoxaline-2,3-dithione,pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 333.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.39800 |
| Flash Point | 155.6ºC |
| Exact Mass | 265.07100 |
| PSA | 107.79000 |
| LogP | 3.65360 |
| InChIKey | PUPDJELTOUMVNM-UHFFFAOYSA-N |
| SMILES | C1CCNC1.S=c1[nH]c2ccccc2[nH]c1=S |
| 2,3-Quinoxalinedithiol compd. with pyrrolidine (1:1) |
| Pyrrolidinium monosalt of 2,3-quinoxalinedithiol |