Triphenyl-(2-pyridinylmethyl)-phosphoniumbromide structure
|
Common Name | Triphenyl-(2-pyridinylmethyl)-phosphoniumbromide | ||
|---|---|---|---|---|
| CAS Number | 73870-22-1 | Molecular Weight | 434.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21BrNP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl(pyridin-2-ylmethyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H21BrNP |
|---|---|
| Molecular Weight | 434.30800 |
| Exact Mass | 433.05900 |
| PSA | 26.48000 |
| LogP | 1.57970 |
| InChIKey | UCECZWKGWRJAFG-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc([P+](Cc2ccccn2)(c2ccccc2)c2ccccc2)cc1 |
|
~92%
Triphenyl-(2-py... CAS#:73870-22-1 |
| Literature: Carsky, Petr; Huenig, Siegfried; Stemmler, Ingo; Scheutzow, Dieter Liebigs Annalen der Chemie, 1980 , # 2 p. 291 - 304 |
|
~%
Triphenyl-(2-py... CAS#:73870-22-1 |
| Literature: Sugimoto, Hiroshi; Kuramoto, Keigo; Inoue, Shohei Journal of the Chemical Society. Perkin Transactions 1, 2002 , # 15 p. 1826 - 1830 |
| Phosphonium,triphenyl(2-pyridinylmethyl)-,bromide (1:1) |
| Triphenyl(2-picolyl)phosphoniumbromid |
| Phosphonium,triphenyl(2-pyridinylmethyl)-,bromide (9CI) |
| TRIPHENYL-(2-PYRIDINYLMETHYL)-PHOSPHONIUMBROMIDE |
| 2-(Pyridylmethyl)triphenylphosphonium bromide |
| triphenyl(pyridin-2-ylmethyl)phosphonium bromide |
| pyridine-2-yl-methyltriphenylphosphonium bromide |