1-[2,2-dibromo-1-(4-ethoxyphenyl)ethyl]-4-ethoxybenzene structure
|
Common Name | 1-[2,2-dibromo-1-(4-ethoxyphenyl)ethyl]-4-ethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 7388-30-9 | Molecular Weight | 428.15800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2,2-dibromo-1-(4-ethoxyphenyl)ethyl]-4-ethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20Br2O2 |
|---|---|
| Molecular Weight | 428.15800 |
| Exact Mass | 425.98300 |
| PSA | 18.46000 |
| LogP | 5.73180 |
| InChIKey | IFSJHPZRUVDPCT-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(c2ccc(OCC)cc2)C(Br)Br)cc1 |
|
~%
1-[2,2-dibromo-... CAS#:7388-30-9 |
| Literature: Harris; Frankforter Journal of the American Chemical Society, 1926 , vol. 48, p. 3148 |
|
~%
Detail
|
| Literature: Brand; Bausch Journal fuer Praktische Chemie (Leipzig), 1930 , vol. <2> 127, p. 219,225 |
| Benzene,1,1'-(2,2-dibromoethylidene)bis[4-ethoxy |
| 1,1-bis-(4-ethoxy-phenyl)-2,2-dibromo-ethane |
| 1,1-Bis-(4-aethoxy-phenyl)-2,2-dibrom-aethan |
| Ethane,1,1-dibromo-2,2-bis(p-ethoxyphenyl) |