Acetamide,2-chloro-N-[3-(2,2-dimethyl-1-aziridinyl)-1,4-dihydro-1,4-dioxo-2-naphthalenyl]- structure
|
Common Name | Acetamide,2-chloro-N-[3-(2,2-dimethyl-1-aziridinyl)-1,4-dihydro-1,4-dioxo-2-naphthalenyl]- | ||
|---|---|---|---|---|
| CAS Number | 73882-21-0 | Molecular Weight | 318.75500 | |
| Density | 1.41g/cm3 | Boiling Point | 482.4ºC at 760mmHg | |
| Molecular Formula | C16H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | 2-chloro-N-[3-(2,2-dimethylaziridin-1-yl)-1,4-dioxonaphthalen-2-yl]acetamide |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 482.4ºC at 760mmHg |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.75500 |
| Flash Point | 245.6ºC |
| Exact Mass | 318.07700 |
| PSA | 66.25000 |
| LogP | 2.05520 |
| Index of Refraction | 1.637 |
| InChIKey | GGTUSSLXARMCGT-UHFFFAOYSA-N |
| SMILES | CC1(C)CN1C1=C(NC(=O)CCl)C(=O)c2ccccc2C1=O |
|
~62%
Acetamide,2-chl... CAS#:73882-21-0 |
| Literature: Antonini, Ippolito; Claudi, Francesco; Cristalli, Gloria; Grifantini, Mario; Martelli, Sante Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 181 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |