5,5'-oxybis(5-methylene-2-furaldehyde) structure
|
Common Name | 5,5'-oxybis(5-methylene-2-furaldehyde) | ||
|---|---|---|---|---|
| CAS Number | 7389-38-0 | Molecular Weight | 234.20 | |
| Density | 1.313g/cm3 at 25 ℃ | Boiling Point | 404.8士45.0°℃ | |
| Molecular Formula | C12H10O5 | Melting Point | 113.5-115.5℃ | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5,5'-oxybis(5-methylene-2-furaldehyde)Cirsiumaldehyde can be isolated from the roots of Anemone altaica[1]. |
| Name | 5-[(5-formylfuran-2-yl)methoxymethyl]furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Description | Cirsiumaldehyde can be isolated from the roots of Anemone altaica[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.313g/cm3 at 25 ℃ |
|---|---|
| Boiling Point | 404.8士45.0°℃ |
| Melting Point | 113.5-115.5℃ |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.20 |
| Exact Mass | 234.05300 |
| PSA | 69.65000 |
| LogP | 2.21440 |
| InChIKey | TZTWOBUHCLWLNK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(COCc2ccc(C=O)o2)o1 |
| HS Code | 2932190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| bis(5-formyl-2-furfuryl) ether |
| 2-Furancarboxaldehyde,5,5'-(oxybis(methylene))bis |
| O-Bisme-furaldehyde |
| 5,5'-[oxy-bis(methylene)]bis(2-furfural) |
| 5,5'-(oxy-bis(methylene))bis-2-furaldehyde |
| 5,5'-Oxybis(5-methylene-2-furaldehyde) |