5-methyl-1,3-diphenyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-methyl-1,3-diphenyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 739-50-4 | Molecular Weight | 294.30500 | |
| Density | 1.299g/cm3 | Boiling Point | 425.9ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 5-methyl-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 425.9ºC at 760 mmHg |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Flash Point | 185.9ºC |
| Exact Mass | 294.10000 |
| PSA | 57.69000 |
| LogP | 2.95250 |
| Index of Refraction | 1.62 |
| InChIKey | XDQBLCQRXUTTCK-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
|
~89%
5-methyl-1,3-di... CAS#:739-50-4 |
| Literature: Takahata, Hiroki; Nakajima, Tomoko; Nakano, Masaharu; Tomiguchi, Akira; Yamazaki, Takao Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 10 p. 4299 - 4308 |
|
~%
5-methyl-1,3-di... CAS#:739-50-4 |
| Literature: Takahata, Hiroki; Nakajima, Tomoko; Yamazaki, Takao Synthetic Communications, 1984 , vol. 14, # 7 p. 675 - 680 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-methyl-1,3-diphenyl-pyrimidine-2,4,6-trione |
| 5-Methyl-1.3-diphenyl-barbitursaeure |
| Barbituric acid,5-methyl-1,3-diphenyl |
| 1.3-Diphenyl-5-methyl-barbitursaeure |
| Barbituric acid,1,3-diphenyl-5-methyl |
| 1,3-Diphenyl-5-methylbarbituric acid |
| 1,3-Diphenyl-5-methyl-2,4,6(1H,3H,5H)-pyrimidinetrione |