2-Propen-1-one,3-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)- structure
|
Common Name | 2-Propen-1-one,3-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7397-23-1 | Molecular Weight | 270.25500 | |
| Density | 1.316g/cm3 | Boiling Point | 420.6ºC at 760 mmHg | |
| Molecular Formula | C16H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | 3-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 420.6ºC at 760 mmHg |
| Molecular Formula | C16H11FO3 |
| Molecular Weight | 270.25500 |
| Flash Point | 200.9ºC |
| Exact Mass | 270.06900 |
| PSA | 35.53000 |
| LogP | 3.45050 |
| Index of Refraction | 1.632 |
| InChIKey | HDSDUHZGXYSYKW-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzo[1,3]dioxol-5-yl-1-(4-fluoro-phenyl)-propenone |
| 3-benzo[1,3]dioxol-5-yl-1-(4-fluorophenyl)prop-2-en-1-one |
| 4'-Fluor-3,4-methylendioxy-chalkon |