sodium,3-hydroxy-2-nitropropan-1-olate structure
|
Common Name | sodium,3-hydroxy-2-nitropropan-1-olate | ||
|---|---|---|---|---|
| CAS Number | 73972-43-7 | Molecular Weight | 143.07400 | |
| Density | N/A | Boiling Point | 363.2ºC at 760 mmHg | |
| Molecular Formula | C3H6NNaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | sodium,3-hydroxy-2-nitropropan-1-olate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 363.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C3H6NNaO4 |
| Molecular Weight | 143.07400 |
| Flash Point | 176.8ºC |
| Exact Mass | 143.01900 |
| PSA | 89.11000 |
| InChIKey | NWSCUKIRCCHDHL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(C[O-])CO.[Na+] |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Propanediol,2-nitro-,sodium salt |
| SODIUM 3-HYDROXY-2-NITRO-PROPAN-1-OLATE |
| 2-Nitro-1,3-propanediol sodium salt |