ethyl 4-oxo-1-phenyl-tetralin-2-carboxylate structure
|
Common Name | ethyl 4-oxo-1-phenyl-tetralin-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7399-03-3 | Molecular Weight | 294.34400 | |
| Density | 1.172g/cm3 | Boiling Point | 416.3ºC at 760 mmHg | |
| Molecular Formula | C19H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | ethyl 4-oxo-1-phenyl-2,3-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 416.3ºC at 760 mmHg |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.34400 |
| Flash Point | 182.7ºC |
| Exact Mass | 294.12600 |
| PSA | 43.37000 |
| LogP | 3.58420 |
| Index of Refraction | 1.576 |
| InChIKey | LAKGJAYWSVCIGK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(=O)c2ccccc2C1c1ccccc1 |
|
~%
ethyl 4-oxo-1-p... CAS#:7399-03-3 |
| Literature: Hewett Journal of the Chemical Society, 1936 , p. 596,598 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethyl 4-oxo-1-phenyl-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| HMS3080E20 |