[(2-nitrophenyl)methylamino]methanesulfonic acid
![[(2-nitrophenyl)methylamino]methanesulfonic acid Structure](https://image.chemsrc.com/caspic/226/7400-34-2.png)
[(2-nitrophenyl)methylamino]methanesulfonic acid structure
|
Common Name | [(2-nitrophenyl)methylamino]methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 7400-34-2 | Molecular Weight | 246.24000 | |
| Density | 1.525g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2-nitrophenyl)methylamino]methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.525g/cm3 |
|---|---|
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24000 |
| Exact Mass | 246.03100 |
| PSA | 120.60000 |
| LogP | 2.52460 |
| Index of Refraction | 1.611 |
| InChIKey | SMJUPFMNYVJGAD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CNCS(=O)(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1904-78-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-Nitro-benzylamino)-methansulfonsaeure |
| (2-nitro-benzylamino)-methanesulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: Related downstream products(CAS) of [(2-nitrophenyl)methylamino]methanesulfonic acid: 1904-78-5. |
| Q: What is the CAS number of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: CAS number of [(2-nitrophenyl)methylamino]methanesulfonic acid is 7400-34-2. |
| Q: What is the polar surface area (PSA) of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: Polar surface area (PSA) of [(2-nitrophenyl)methylamino]methanesulfonic acid is 120.60000. |
| Q: What is the Chinese name of 7400-34-2? |
| A: Chinese name of 7400-34-2 is 7400-34-2. |
| Q: What is the English name of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: The English name of [(2-nitrophenyl)methylamino]methanesulfonic acid is [(2-nitrophenyl)methylamino]methanesulfonic acid. |
| Q: What English synonyms does [(2-nitrophenyl)methylamino]methanesulfonic acid have? |
| A: English synonyms of [(2-nitrophenyl)methylamino]methanesulfonic acid: (2-Nitro-benzylamino)-methansulfonsaeure, (2-nitro-benzylamino)-methanesulfonic acid. |
| Q: What is the molecular formula of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: Molecular formula of [(2-nitrophenyl)methylamino]methanesulfonic acid is C8H10N2O5S. |
| Q: What is the molecular weight of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: Molecular weight of [(2-nitrophenyl)methylamino]methanesulfonic acid is 246.24000. |
| Q: What is the InChIKey of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: InChIKey of [(2-nitrophenyl)methylamino]methanesulfonic acid is SMJUPFMNYVJGAD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [(2-nitrophenyl)methylamino]methanesulfonic acid? |
| A: SMILES notation of [(2-nitrophenyl)methylamino]methanesulfonic acid is O=[N+]([O-])c1ccccc1CNCS(=O)(=O)O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |