2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid
Modify Date: 2026-06-30 16:44:45
2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid structure
|
Common Name | 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 74006-38-5 | Molecular Weight | 172.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12O4 |
|---|---|
| Molecular Weight | 172.18 |
| InChIKey | APXCNLZAUXSRMY-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)C1COC(C)(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: CAS number of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is 74006-38-5. |
| Q: What is the SMILES notation of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: SMILES notation of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is C=C(C(=O)O)C1COC(C)(C)O1. |
| Q: What is the molecular formula of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: Molecular formula of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is C8H12O4. |
| Q: What is the molecular weight of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: Molecular weight of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is 172.18. |
| Q: What is the Chinese name of 74006-38-5? |
| A: Chinese name of 74006-38-5 is 74006-38-5. |
| Q: What is the InChIKey of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: InChIKey of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is APXCNLZAUXSRMY-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid? |
| A: The English name of 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid is 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid. |