ethyl 5-ethyl-2,4-dioxo-6-phenyl-1,3-thiazine-3-carboxylate structure
|
Common Name | ethyl 5-ethyl-2,4-dioxo-6-phenyl-1,3-thiazine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 74007-81-1 | Molecular Weight | 305.34900 | |
| Density | 1.298g/cm3 | Boiling Point | 442.1ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
| Name | ethyl 5-ethyl-2,4-dioxo-6-phenyl-1,3-thiazine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760 mmHg |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.34900 |
| Flash Point | 221.2ºC |
| Exact Mass | 305.07200 |
| PSA | 93.61000 |
| LogP | 2.50400 |
| Index of Refraction | 1.59 |
| InChIKey | BTHSXVKALBMZQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)n1c(=O)sc(-c2ccccc2)c(CC)c1=O |
|
~%
ethyl 5-ethyl-2... CAS#:74007-81-1 |
| Literature: Taborsky,R.G.; Starkey,R.J. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 775 - 780 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Carboxyethyl-5-ethyl-6-phenyl-m-thiazane-2,4-dione |
| 2H-1,3-Thiazine-3-carboxylic acid,3,4,5,6-tetrahydro-2,4-dioxo-5-ethyl-6-phenyl-,ethyl ester |
| 2,4-Dioxo-5-ethyl-6-phenyl-3,4,5,6-tetrahydro-2H-1,3-thiazine-3-carboxylic acid ethyl ester |
| 3-Ethoxycarbonyl-2,4-dioxo-5-ethyl-6-phenyl-tetrahydro-1,3-thiazin |