Pyridinium,2-chloro-1-[2-(4-chlorophenyl)-2-oxoethyl]-, bromide (1:1) structure
|
Common Name | Pyridinium,2-chloro-1-[2-(4-chlorophenyl)-2-oxoethyl]-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7401-14-1 | Molecular Weight | 347.03500 | |
| Density | 1.34g/cm3 | Boiling Point | 436.3ºC at 760mmHg | |
| Molecular Formula | C13H10BrCl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.7ºC | |
| Name | 1-(4-chlorophenyl)-2-(2-chloropyridin-1-ium-1-yl)ethanone,bromide |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760mmHg |
| Molecular Formula | C13H10BrCl2NO |
| Molecular Weight | 347.03500 |
| Flash Point | 217.7ºC |
| Exact Mass | 344.93200 |
| PSA | 20.95000 |
| LogP | 0.16780 |
| Index of Refraction | 1.624 |
| InChIKey | FBQRGJCPONHRBB-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1Cl)c1ccc(Cl)cc1.[Br-] |
|
~%
Pyridinium,2-ch... CAS#:7401-14-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |