Morpholinium,4-(2-oxo-2-phenylethyl)-4-phenyl-, bromide (1:1) structure
|
Common Name | Morpholinium,4-(2-oxo-2-phenylethyl)-4-phenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7401-21-0 | Molecular Weight | 282.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20NO2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-(4-phenylmorpholin-4-ium-4-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20NO2+ |
|---|---|
| Molecular Weight | 282.35700 |
| Exact Mass | 282.14900 |
| PSA | 26.30000 |
| LogP | 3.00680 |
| InChIKey | YCVTUSIXNJAXKA-UHFFFAOYSA-N |
| SMILES | O=C(C[N+]1(c2ccccc2)CCOCC1)c1ccccc1 |
|
~%
Morpholinium,4-... CAS#:7401-21-0 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4011 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-phenacyl-4-phenyl-morpholinium,bromide |