2-Propenamide,2-cyano-3-[[(propylamino)carbonyl]amino]
![2-Propenamide,2-cyano-3-[[(propylamino)carbonyl]amino] Structure](https://image.chemsrc.com/caspic/259/7401-86-7.png)
2-Propenamide,2-cyano-3-[[(propylamino)carbonyl]amino] structure
|
Common Name | 2-Propenamide,2-cyano-3-[[(propylamino)carbonyl]amino] | ||
|---|---|---|---|---|
| CAS Number | 7401-86-7 | Molecular Weight | 196.20600 | |
| Density | 1.204g/cm3 | Boiling Point | 381.5ºC at 760 mmHg | |
| Molecular Formula | C8H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-cyano-3-(propylcarbamoylamino)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 381.5ºC at 760 mmHg |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.20600 |
| Flash Point | 184.5ºC |
| Exact Mass | 196.09600 |
| PSA | 108.01000 |
| LogP | 1.07048 |
| Index of Refraction | 1.522 |
| InChIKey | GMJUIWYJWYWYEO-AATRIKPKSA-N |
| SMILES | CCCNC(=O)NC=C(C#N)C(N)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-Propenamide,2... CAS#:7401-86-7 |
| Literature: Whitehead; Traverso Journal of the American Chemical Society, 1955 , vol. 77, p. 5872,5875 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Methylphenylamino-2-cyan-acrylsaeure-aethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: Polar surface area (PSA) of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 108.01000. |
| Q: What is the English name of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: The English name of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 2-cyano-3-(propylcarbamoylamino)prop-2-enamide. |
| Q: What is the boiling point of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: Boiling point of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 381.5ºC at 760 mmHg. |
| Q: What is the molecular formula of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: Molecular formula of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is C8H12N4O2. |
| Q: What is the SMILES notation of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: SMILES notation of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is CCCNC(=O)NC=C(C#N)C(N)=O. |
| Q: What is the LogP of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: LogP of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 1.07048. |
| Q: What English synonyms does 2-cyano-3-(propylcarbamoylamino)prop-2-enamide have? |
| A: English synonyms of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide: 3-Methylphenylamino-2-cyan-acrylsaeure-aethylester. |
| Q: What is the CAS number of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: CAS number of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 7401-86-7. |
| Q: What is the molecular weight of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: Molecular weight of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is 196.20600. |
| Q: What is the InChIKey of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide? |
| A: InChIKey of 2-cyano-3-(propylcarbamoylamino)prop-2-enamide is GMJUIWYJWYWYEO-AATRIKPKSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |