RICAMYCIN structure
|
Common Name | RICAMYCIN | ||
|---|---|---|---|---|
| CAS Number | 74014-51-0 | Molecular Weight | 827.99500 | |
| Density | 1.21 g/cm3 | Boiling Point | 879.3ºC at 760 mmHg | |
| Molecular Formula | C42H69NO15 | Melting Point | 116° | |
| MSDS | N/A | Flash Point | 485.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rokitamycin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.21 g/cm3 |
|---|---|
| Boiling Point | 879.3ºC at 760 mmHg |
| Melting Point | 116° |
| Molecular Formula | C42H69NO15 |
| Molecular Weight | 827.99500 |
| Flash Point | 485.6ºC |
| Exact Mass | 827.46700 |
| PSA | 206.05000 |
| LogP | 3.15750 |
| Index of Refraction | 1.535 |
| InChIKey | VYWWNRMSAPEJLS-WZTYUKAQSA-N |
| SMILES | CCCC(=O)OC1C(C)OC(OC2C(C)OC(OC3C(CC=O)CC(C)C(O)C=CC=CCC(C)OC(=O)CC(O)C3OC)C(O)C2N(C)C)CC1(C)OC(=O)CC |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Leucomycin V,4B-butanoate 3B-propanoate (9CI) |
| Leummycin V 4B-bu-tanoate 3 B-propanoate |
| T'urimyein H4 |
| Rikamycin |
| 3''-O-propionyl leucomycin A5 |
| Ricamycin |
| TMS 19Q |
| M-19-Q |
| 3''-Propionylleucomycin A5 |
| Rokital |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of rokitamycin? |
| A: Molecular weight of rokitamycin is 827.99500. |
| Q: What is the CAS number of rokitamycin? |
| A: CAS number of rokitamycin is 74014-51-0. |
| Q: What is the polar surface area (PSA) of rokitamycin? |
| A: Polar surface area (PSA) of rokitamycin is 206.05000. |
| Q: What is the molecular formula of rokitamycin? |
| A: Molecular formula of rokitamycin is C42H69NO15. |
| Q: What is the InChIKey of rokitamycin? |
| A: InChIKey of rokitamycin is VYWWNRMSAPEJLS-WZTYUKAQSA-N. |
| Q: What is the LogP of rokitamycin? |
| A: LogP of rokitamycin is 3.15750. |
| Q: What is the SMILES notation of rokitamycin? |
| A: SMILES notation of rokitamycin is CCCC(=O)OC1C(C)OC(OC2C(C)OC(OC3C(CC=O)CC(C)C(O)C=CC=CCC(C)OC(=O)CC(O)C3OC)C(O)C2N(C)C)CC1(C)OC(=O)CC. |
| Q: What is the boiling point of rokitamycin? |
| A: Boiling point of rokitamycin is 879.3ºC at 760 mmHg. |
| Q: What is the melting point of rokitamycin? |
| A: Melting point of rokitamycin is 116°. |
| Q: What is the English name of rokitamycin? |
| A: The English name of rokitamycin is rokitamycin. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |