ethyl (3-aminophenyl)carbamoylformate structure
|
Common Name | ethyl (3-aminophenyl)carbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 7402-43-9 | Molecular Weight | 208.21400 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(3-aminoanilino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Exact Mass | 208.08500 |
| PSA | 81.42000 |
| LogP | 1.42460 |
| Index of Refraction | 1.608 |
| InChIKey | OKLRIUSQOWPSHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1cccc(N)c1 |
| HS Code | 2924299090 |
|---|
|
~%
ethyl (3-aminop... CAS#:7402-43-9 |
| Literature: The Upjohn Company Patent: US4128660 A1, 1978 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-oxanilsaeure-aethylester |
| ethyl[(3-aminophenyl)amino](oxo)acetate |
| 3'-amino-oxanilic acid,ethyl ester |
| 1--Ethyl 3'-amino-oxanilate |