3'-Amino-2',3'-dideoxyadenosine structure
|
Common Name | 3'-Amino-2',3'-dideoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 7403-25-0 | Molecular Weight | 250.25700 | |
| Density | 1.91 g/cm3 | Boiling Point | 571.6ºC at 760 mmHg | |
| Molecular Formula | C10H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.5ºC | |
| Name | [(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.91 g/cm3 |
|---|---|
| Boiling Point | 571.6ºC at 760 mmHg |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.25700 |
| Flash Point | 299.5ºC |
| Exact Mass | 250.11800 |
| PSA | 125.10000 |
| LogP | 0.29710 |
| Appearance of Characters | Powder | Off-white to Yellow |
| Index of Refraction | 1.889 |
| InChIKey | MVAJRASUDLEWKZ-RRKCRQDMSA-N |
| SMILES | Nc1ncnc2c1ncn2C1CC(N)C(CO)O1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Adenosine,3'-amino-2',3'-dideoxy |
| 2',3'-Dideoxy-3'-aminoadenosine |
| HG1025 |
| 3'-amino-2',3'-dideoxy-adenosine |